| CAS | 61-90-5 |
| Structure |  |
| Synonyms | 4-Methyl-L-norvalin |
| IUPAC Name | (2S)-2-Amino-4-methylpentanoic acid |
| Molecular Weight | 131.17 |
| Molecular Formula | C6H13NO2 |
| Canonical SMILES | CC(C)CC(C(=O)O)N |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChI Key | ROHFNLRQFUQHCH-YFKPBYRVSA-N |
| Boiling Point | 122-134 °C |
| Melting Point | >300 °C(lit.) |
| Flash Point | 145-148 °C |
| Purity | 99% |
| Density | 1.293 g/cm³ |
| Refractive Index | 1.4630 |
| pKa | 2.328(at 25 °C) |
| pH | 5.5-7.0 (1%, H₂O, 25°C) |
| Solubility in Water | 24.5 g/L |
| Appearance | White to off-white powder |
Our products and services are for research use only.