| CAS | 73-32-5 |
| Structure |  |
| Synonyms | (2S,3S)-Alpha-amino-beta-merthylvalericacid |
| IUPAC Name | (2S,3S)-2-Amino-3-methylpentanoic acid |
| Molecular Weight | 131.17 |
| Molecular Formula | C6H13NO2 |
| Canonical SMILES | CCC(C)C(C(=O)O)N |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| InChI Key | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| Boiling Point | 225.8±23.0 °C |
| Melting Point | 288 °C(lit.) |
| Flash Point | 168-170 °C |
| Purity | 99% |
| Density | 1.2930 g/cm³ |
| Refractive Index | 40.5 ° (C=4, 6mol/L HCl) |
| pKa | pK1: 2.32, pK2: 9.76 (25°C) |
| pH | 5.5-6.5 (40g/l, H₂O, 20°C) |
| Solubility in Water | 41.2 g/L (50 ºC) |
| Appearance | White to off-white powder |
Our products and services are for research use only.