| CAS | 556-33-2 |
| Structure |  |
| Synonyms | α-Diglycylglycin |
| IUPAC Name | 2-[[2-[(2-Aminoacetyl)amino]acetyl]amino]acetic acid |
| Molecular Weight | 189.17 |
| Molecular Formula | C6H11N3O4 |
| Canonical SMILES | C(C(=O)NCC(=O)NCC(=O)O)N |
| InChI | InChI=1S/C6H11N3O4/c7-1-4(10)8-2-5(11)9-3-6(12)13/h1-3,7H2,(H,8,10)(H,9,11)(H,12,13) |
| InChI Key | XKUKSGPZAADMRA-UHFFFAOYSA-N |
| Boiling Point | 324.41 °C |
| Melting Point | 240-250 °C |
| Purity | 98% |
| Density | 1.4204 g/cm³ |
| Refractive Index | 1.5250 |
| pKa | 3.225(at 25 °C) |
| pH | 4.5-6.0 (0.5M, H2O, 25°C) |
| Solubility in Water | 94.6 g/L |
| Appearance | White to off-white solid |
Our products and services are for research use only.