| CAS | 6893-26-1 |
| Structure |  |
| Synonyms | D-Glutamate |
| IUPAC Name | (2R)-2-Aminopentanedioic acid |
| Molecular Weight | 147.13 |
| Molecular Formula | C5H9NO4 |
| Canonical SMILES | C(CC(=O)O)C(C(=O)O)N |
| InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1 |
| InChI Key | WHUUTDBJXJRKMK-GSVOUGTGSA-N |
| Boiling Point | 267.21 °C |
| Melting Point | 200-202 °C(lit.) |
| Flash Point | 155.7 °C |
| Purity | 99% |
| Density | 1.5380 g/cm³ |
| Refractive Index | 1.4210 |
| pKa | pK1: 2.162, pK2: 4.272, pK3 :9.358 |
| Solubility in Water | 7 g/L |
| Appearance | White to off-white powder |
Our products and services are for research use only.