| CAS | 621-82-9 |
| Structure |  |
| Synonyms | (2E)-3-Phenyl-2-propenoic acid |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
| Molecular Weight | 148.16 |
| Molecular Formula | C9H8O2 |
| Canonical SMILES | C1=CC=C(C=C1)/C=C/C(=O)O |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Boiling Point | 300 °C (lit.) |
| Melting Point | 133 °C (lit.) |
| Flash Point | >230°F |
| Purity | 98% |
| Density | 1.25 g/ml |
| pKa | 4.46 |
| pH | 3.76 (1 mM solution) |
| Solubility in Water | 511.2 mg/L |
| Appearance | White to off-white solid |
Our products and services are for research use only.